Organic acids and derivatives
Filtered Search Results
Ethyl 2-methylbutyrate, 99%
CAS: 7452-79-1 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.19 MDL Number: MFCD00012217 InChI Key: HCRBXQFHJMCTLF-UHFFFAOYSA-N Synonym: ethyl 2-methylbutyrate,butanoic acid, 2-methyl-, ethyl ester,butyric acid, 2-methyl-, ethyl ester,ethyl 2-methyl butyrate,ethyl alpha-methylbutyrate,dl-2-methylbutyric acid ethyl ester,ethyl 2-methyl-butanoate,ethyl .alpha.-methylbutyrate,2-methylbutanoic acid ethyl ester,butyric acid, 2-methyl-, ethyl ester 8ci PubChem CID: 24020 IUPAC Name: ethyl 2-methylbutanoate SMILES: CCC(C)C(=O)OCC
| PubChem CID | 24020 |
|---|---|
| CAS | 7452-79-1 |
| Molecular Weight (g/mol) | 130.19 |
| MDL Number | MFCD00012217 |
| SMILES | CCC(C)C(=O)OCC |
| Synonym | ethyl 2-methylbutyrate,butanoic acid, 2-methyl-, ethyl ester,butyric acid, 2-methyl-, ethyl ester,ethyl 2-methyl butyrate,ethyl alpha-methylbutyrate,dl-2-methylbutyric acid ethyl ester,ethyl 2-methyl-butanoate,ethyl .alpha.-methylbutyrate,2-methylbutanoic acid ethyl ester,butyric acid, 2-methyl-, ethyl ester 8ci |
| IUPAC Name | ethyl 2-methylbutanoate |
| InChI Key | HCRBXQFHJMCTLF-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
Acetazolamide, 99%
CAS: 59-66-5 Molecular Formula: C4H6N4O3S2 Molecular Weight (g/mol): 222.24 MDL Number: MFCD00003105 InChI Key: BZKPWHYZMXOIDC-UHFFFAOYSA-N Synonym: acetazolamide,diamox,acetazolamid,diacarb,glaupax,defiltran,nephramide,acetamox,cidamex,diluran PubChem CID: 1986 ChEBI: CHEBI:27690 IUPAC Name: N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide SMILES: CC(=O)NC1=NN=C(S1)S(N)(=O)=O
| PubChem CID | 1986 |
|---|---|
| CAS | 59-66-5 |
| Molecular Weight (g/mol) | 222.24 |
| ChEBI | CHEBI:27690 |
| MDL Number | MFCD00003105 |
| SMILES | CC(=O)NC1=NN=C(S1)S(N)(=O)=O |
| Synonym | acetazolamide,diamox,acetazolamid,diacarb,glaupax,defiltran,nephramide,acetamox,cidamex,diluran |
| IUPAC Name | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
| InChI Key | BZKPWHYZMXOIDC-UHFFFAOYSA-N |
| Molecular Formula | C4H6N4O3S2 |
Dimethyl oxalate, 99%
CAS: 553-90-2 Molecular Formula: C4H6O4 Molecular Weight (g/mol): 118.09 MDL Number: MFCD00008442 InChI Key: LOMVENUNSWAXEN-UHFFFAOYSA-N Synonym: methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid PubChem CID: 11120 ChEBI: CHEBI:6859 IUPAC Name: dimethyl oxalate SMILES: COC(=O)C(=O)OC
| PubChem CID | 11120 |
|---|---|
| CAS | 553-90-2 |
| Molecular Weight (g/mol) | 118.09 |
| ChEBI | CHEBI:6859 |
| MDL Number | MFCD00008442 |
| SMILES | COC(=O)C(=O)OC |
| Synonym | methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid |
| IUPAC Name | dimethyl oxalate |
| InChI Key | LOMVENUNSWAXEN-UHFFFAOYSA-N |
| Molecular Formula | C4H6O4 |
2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one, 97%
CAS: 5381-99-7 Molecular Formula: C7H4ClO3P Molecular Weight (g/mol): 202.53 MDL Number: MFCD00013353 InChI Key: BVOITXUNGDUXRW-UHFFFAOYNA-N Synonym: 2-chloro-4h-1,3,2-benzodioxaphosphorin-4-one,2-chloro-4h-benzo d 1,3,2 dioxaphosphinin-4-one,van boom's reagent,2-chloro-4h-1,2,3-benzodioxaphosphorin-4-one,4h-1,3,2-benzodioxaphosphorin-4-one, 2-chloro,salicylchlorophosphite,salicyl chlorophosphite,acmc-1an3b,2-chloro-4h-1,3,2-benzodioxaphosphinin-4-one,salicylchlorophosphite; van boom's reagent PubChem CID: 237010 IUPAC Name: 2-chloro-1,3,2-benzodioxaphosphinin-4-one SMILES: ClP1OC(=O)C2=CC=CC=C2O1
| PubChem CID | 237010 |
|---|---|
| CAS | 5381-99-7 |
| Molecular Weight (g/mol) | 202.53 |
| MDL Number | MFCD00013353 |
| SMILES | ClP1OC(=O)C2=CC=CC=C2O1 |
| Synonym | 2-chloro-4h-1,3,2-benzodioxaphosphorin-4-one,2-chloro-4h-benzo d 1,3,2 dioxaphosphinin-4-one,van boom's reagent,2-chloro-4h-1,2,3-benzodioxaphosphorin-4-one,4h-1,3,2-benzodioxaphosphorin-4-one, 2-chloro,salicylchlorophosphite,salicyl chlorophosphite,acmc-1an3b,2-chloro-4h-1,3,2-benzodioxaphosphinin-4-one,salicylchlorophosphite; van boom's reagent |
| IUPAC Name | 2-chloro-1,3,2-benzodioxaphosphinin-4-one |
| InChI Key | BVOITXUNGDUXRW-UHFFFAOYNA-N |
| Molecular Formula | C7H4ClO3P |
trans-Ethyl crotonate, 96%
CAS: 623-70-1 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.14 MDL Number: MFCD00009289 InChI Key: ZFDIRQKJPRINOQ-HWKANZROSA-N Synonym: ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e PubChem CID: 429065 IUPAC Name: ethyl (E)-but-2-enoate SMILES: CCOC(=O)\C=C\C
| PubChem CID | 429065 |
|---|---|
| CAS | 623-70-1 |
| Molecular Weight (g/mol) | 114.14 |
| MDL Number | MFCD00009289 |
| SMILES | CCOC(=O)\C=C\C |
| Synonym | ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e |
| IUPAC Name | ethyl (E)-but-2-enoate |
| InChI Key | ZFDIRQKJPRINOQ-HWKANZROSA-N |
| Molecular Formula | C6H10O2 |
2,2,3,3,3-Pentafluoropropyl methacrylate, 97%, stab.
CAS: 45115-53-5 Molecular Formula: C7H7F5O2 Molecular Weight (g/mol): 218.123 MDL Number: MFCD00039256 InChI Key: CLISWDZSTWQFNX-UHFFFAOYSA-N Synonym: 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor PubChem CID: 123516 IUPAC Name: 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(F)(F)F)(F)F
| PubChem CID | 123516 |
|---|---|
| CAS | 45115-53-5 |
| Molecular Weight (g/mol) | 218.123 |
| MDL Number | MFCD00039256 |
| SMILES | CC(=C)C(=O)OCC(C(F)(F)F)(F)F |
| Synonym | 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate |
| InChI Key | CLISWDZSTWQFNX-UHFFFAOYSA-N |
| Molecular Formula | C7H7F5O2 |
Dimethyl fumarate, 99%
CAS: 624-49-7 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.126 MDL Number: MFCD00064438 InChI Key: LDCRTTXIJACKKU-ONEGZZNKSA-N Synonym: dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate PubChem CID: 637568 ChEBI: CHEBI:76004 IUPAC Name: dimethyl (E)-but-2-enedioate SMILES: COC(=O)C=CC(=O)OC
| PubChem CID | 637568 |
|---|---|
| CAS | 624-49-7 |
| Molecular Weight (g/mol) | 144.126 |
| ChEBI | CHEBI:76004 |
| MDL Number | MFCD00064438 |
| SMILES | COC(=O)C=CC(=O)OC |
| Synonym | dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate |
| IUPAC Name | dimethyl (E)-but-2-enedioate |
| InChI Key | LDCRTTXIJACKKU-ONEGZZNKSA-N |
| Molecular Formula | C6H8O4 |
Butyl Acrylate (stabilized with MEHQ) 99.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 141-32-2 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.171 MDL Number: MFCD00009446 InChI Key: CQEYYJKEWSMYFG-UHFFFAOYSA-N Synonym: butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove PubChem CID: 8846 ChEBI: CHEBI:3245 IUPAC Name: butyl prop-2-enoate SMILES: CCCCOC(=O)C=C
| PubChem CID | 8846 |
|---|---|
| CAS | 141-32-2 |
| Molecular Weight (g/mol) | 128.171 |
| ChEBI | CHEBI:3245 |
| MDL Number | MFCD00009446 |
| SMILES | CCCCOC(=O)C=C |
| Synonym | butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove |
| IUPAC Name | butyl prop-2-enoate |
| InChI Key | CQEYYJKEWSMYFG-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
Methanesulfonic Acid 99.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 75-75-2 Molecular Formula: CH4O3S Molecular Weight (g/mol): 96.1 MDL Number: MFCD00007518 InChI Key: AFVFQIVMOAPDHO-UHFFFAOYSA-N Synonym: methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane PubChem CID: 6395 ChEBI: CHEBI:27376 IUPAC Name: methanesulfonic acid SMILES: CS(=O)(=O)O
| PubChem CID | 6395 |
|---|---|
| CAS | 75-75-2 |
| Molecular Weight (g/mol) | 96.1 |
| ChEBI | CHEBI:27376 |
| MDL Number | MFCD00007518 |
| SMILES | CS(=O)(=O)O |
| Synonym | methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane |
| IUPAC Name | methanesulfonic acid |
| InChI Key | AFVFQIVMOAPDHO-UHFFFAOYSA-N |
| Molecular Formula | CH4O3S |
2-Morpholinoethanesulfonic Acid 99.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 4432-31-9 Molecular Formula: C6H13NO4S Molecular Weight (g/mol): 195.233 MDL Number: MFCD00006181 InChI Key: SXGZJKUKBWWHRA-UHFFFAOYSA-N Synonym: 2-morpholinoethanesulfonic acid,4-morpholineethanesulfonic acid,2-n-morpholino ethanesulfonic acid,mes,4-morpholinethanesulfonic acid,2-4-morpholinyl ethanesulfonic acid,morpholineethanesulfonic acid,mes buffering agent,2-morpholinoethanesulphonic acid,morpholino-n-ethylsulfonate PubChem CID: 78165 ChEBI: CHEBI:39005 IUPAC Name: 2-morpholin-4-ylethanesulfonic acid SMILES: C1COCCN1CCS(=O)(=O)O
| PubChem CID | 78165 |
|---|---|
| CAS | 4432-31-9 |
| Molecular Weight (g/mol) | 195.233 |
| ChEBI | CHEBI:39005 |
| MDL Number | MFCD00006181 |
| SMILES | C1COCCN1CCS(=O)(=O)O |
| Synonym | 2-morpholinoethanesulfonic acid,4-morpholineethanesulfonic acid,2-n-morpholino ethanesulfonic acid,mes,4-morpholinethanesulfonic acid,2-4-morpholinyl ethanesulfonic acid,morpholineethanesulfonic acid,mes buffering agent,2-morpholinoethanesulphonic acid,morpholino-n-ethylsulfonate |
| IUPAC Name | 2-morpholin-4-ylethanesulfonic acid |
| InChI Key | SXGZJKUKBWWHRA-UHFFFAOYSA-N |
| Molecular Formula | C6H13NO4S |
Calcium propionate, 98+%
CAS: 4075-81-4 Molecular Formula: C6H10CaO4 Molecular Weight (g/mol): 186.22 MDL Number: MFCD00167354 InChI Key: BCZXFFBUYPCTSJ-UHFFFAOYSA-L Synonym: calcium propionate,calcium dipropionate,calcium propanoate,mycoban,propanoic acid, calcium salt,bioban-c,caswell no. 151,propionic acid, calcium salt,unii-8ai80040kw,hsdb 907 PubChem CID: 19999 ChEBI: CHEBI:81716 IUPAC Name: calcium;propanoate SMILES: [Ca++].CCC([O-])=O.CCC([O-])=O
| PubChem CID | 19999 |
|---|---|
| CAS | 4075-81-4 |
| Molecular Weight (g/mol) | 186.22 |
| ChEBI | CHEBI:81716 |
| MDL Number | MFCD00167354 |
| SMILES | [Ca++].CCC([O-])=O.CCC([O-])=O |
| Synonym | calcium propionate,calcium dipropionate,calcium propanoate,mycoban,propanoic acid, calcium salt,bioban-c,caswell no. 151,propionic acid, calcium salt,unii-8ai80040kw,hsdb 907 |
| IUPAC Name | calcium;propanoate |
| InChI Key | BCZXFFBUYPCTSJ-UHFFFAOYSA-L |
| Molecular Formula | C6H10CaO4 |
Benzeneseleninic anhydride, 98%
CAS: 17697-12-0 Molecular Formula: C12H10O3Se2 Molecular Weight (g/mol): 360.13 MDL Number: MFCD00001991 InChI Key: FHPZOWOEILXXBD-UHFFFAOYSA-N Synonym: benzeneseleninic anhydride,benzeneseleninic acid anhydride,benzeneseleninyl benzeneseleninate,bis phenylseleninic anhydride,benzeneseleninic acid, anhydride,bis benzeneseleninic anhydride,1,3-diphenyldiselenoxane 1,3-dioxide # PubChem CID: 87253 IUPAC Name: phenylseleninyl benzeneseleninate SMILES: C1=CC=C(C=C1)[Se](=O)O[Se](=O)C2=CC=CC=C2
| PubChem CID | 87253 |
|---|---|
| CAS | 17697-12-0 |
| Molecular Weight (g/mol) | 360.13 |
| MDL Number | MFCD00001991 |
| SMILES | C1=CC=C(C=C1)[Se](=O)O[Se](=O)C2=CC=CC=C2 |
| Synonym | benzeneseleninic anhydride,benzeneseleninic acid anhydride,benzeneseleninyl benzeneseleninate,bis phenylseleninic anhydride,benzeneseleninic acid, anhydride,bis benzeneseleninic anhydride,1,3-diphenyldiselenoxane 1,3-dioxide # |
| IUPAC Name | phenylseleninyl benzeneseleninate |
| InChI Key | FHPZOWOEILXXBD-UHFFFAOYSA-N |
| Molecular Formula | C12H10O3Se2 |
4-Hydroxybenzoic Acid Hydrazide, 98%
CAS: 5351-23-5 Molecular Formula: C7H8N2O2 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00007605 InChI Key: ZMZGIVVRBMFZSG-UHFFFAOYSA-N Synonym: 4-hydroxybenzhydrazide,4-hydroxybenzoic acid hydrazide,4-hydroxybenzoic hydrazide,p-hydroxybenzhydrazide,p-hydroxybenzoic acid hydrazide,4-hydroxybenzoylhydrazine,benzoic acid, 4-hydroxy-, hydrazide,p-hydroxybenzoic hydrazide,p-hydroxybenzoyl hydrazine,4-hydroxy-benzoic acid hydrazide PubChem CID: 1742 IUPAC Name: 4-hydroxybenzohydrazide SMILES: C1=CC(=CC=C1C(=O)NN)O
| PubChem CID | 1742 |
|---|---|
| CAS | 5351-23-5 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD00007605 |
| SMILES | C1=CC(=CC=C1C(=O)NN)O |
| Synonym | 4-hydroxybenzhydrazide,4-hydroxybenzoic acid hydrazide,4-hydroxybenzoic hydrazide,p-hydroxybenzhydrazide,p-hydroxybenzoic acid hydrazide,4-hydroxybenzoylhydrazine,benzoic acid, 4-hydroxy-, hydrazide,p-hydroxybenzoic hydrazide,p-hydroxybenzoyl hydrazine,4-hydroxy-benzoic acid hydrazide |
| IUPAC Name | 4-hydroxybenzohydrazide |
| InChI Key | ZMZGIVVRBMFZSG-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O2 |
1-Butylphosphonic acid, 98%
CAS: 3321-64-0 Molecular Formula: C4H11O3P Molecular Weight (g/mol): 138.10 MDL Number: MFCD00012295 InChI Key: UOKRBSXOBUKDGE-UHFFFAOYSA-N Synonym: n-butylphosphonic acid,1-butanephosphonic acid,butylphosphonate,1-butylphosphonic acid,phosphonic acid, butyl,n-butyl phosphonic acid,acmc-1cr41 PubChem CID: 76839 ChEBI: CHEBI:41384 IUPAC Name: butylphosphonic acid SMILES: CCCCP(O)(O)=O
| PubChem CID | 76839 |
|---|---|
| CAS | 3321-64-0 |
| Molecular Weight (g/mol) | 138.10 |
| ChEBI | CHEBI:41384 |
| MDL Number | MFCD00012295 |
| SMILES | CCCCP(O)(O)=O |
| Synonym | n-butylphosphonic acid,1-butanephosphonic acid,butylphosphonate,1-butylphosphonic acid,phosphonic acid, butyl,n-butyl phosphonic acid,acmc-1cr41 |
| IUPAC Name | butylphosphonic acid |
| InChI Key | UOKRBSXOBUKDGE-UHFFFAOYSA-N |
| Molecular Formula | C4H11O3P |
Dimethyl acetylenedicarboxylate, 95%
CAS: 762-42-5 Molecular Formula: C6H6O4 Molecular Weight (g/mol): 142.11 MDL Number: MFCD00008456 InChI Key: VHILMKFSCRWWIJ-UHFFFAOYSA-N Synonym: dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene PubChem CID: 12980 IUPAC Name: dimethyl but-2-ynedioate SMILES: COC(=O)C#CC(=O)OC
| PubChem CID | 12980 |
|---|---|
| CAS | 762-42-5 |
| Molecular Weight (g/mol) | 142.11 |
| MDL Number | MFCD00008456 |
| SMILES | COC(=O)C#CC(=O)OC |
| Synonym | dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene |
| IUPAC Name | dimethyl but-2-ynedioate |
| InChI Key | VHILMKFSCRWWIJ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O4 |